C20H22ClN2O6P — CID 118716142
[2-amino-4-[4-[2-(4-chlorophenyl)-1,3-oxazol-4-yl]phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate (PubChem CID 118716142) has the molecular formula C20H22ClN2O6P and a molecular weight of 452.83 g/mol. Its IUPAC name is [2-amino-4-[4-[2-(4-chlorophenyl)-1,3-oxazol-4-yl]phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate.
| Compound Name | [2-amino-4-[4-[2-(4-chlorophenyl)-1,3-oxazol-4-yl]phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 118716142 |
| Molecular Formula | C20H22ClN2O6P |
| Molecular Weight | 452.83 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | [2-amino-4-[4-[2-(4-chlorophenyl)-1,3-oxazol-4-yl]phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate |
| SMILES | NC(CO)(CCc1ccc(-c2coc(-c3ccc(Cl)cc3)n2)cc1)COP(=O)(O)O |
| InChI | InChI=1S/C20H22ClN2O6P/c21-17-7-5-16(6-8-17)19-23-18(11-28-19)15-3-1-14(2-4-15)9-10-20(22,12-24)13-29-30(25,26)27/h1-8,11,24H,9-10,12-13,22H2,(H2,25,26,27) |
| InChIKey | ONZDQUQGLVVPEN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 139.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.83 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|