C21H22N3O6P — CID 118716148
[2-amino-4-[4-[2-(4-cyanophenyl)-1,3-oxazol-4-yl]phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate (PubChem CID 118716148) has the molecular formula C21H22N3O6P and a molecular weight of 443.40 g/mol. Its IUPAC name is [2-amino-4-[4-[2-(4-cyanophenyl)-1,3-oxazol-4-yl]phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate.
| Compound Name | [2-amino-4-[4-[2-(4-cyanophenyl)-1,3-oxazol-4-yl]phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 118716148 |
| Molecular Formula | C21H22N3O6P |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | [2-amino-4-[4-[2-(4-cyanophenyl)-1,3-oxazol-4-yl]phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate |
| SMILES | N#Cc1ccc(-c2nc(-c3ccc(CCC(N)(CO)COP(=O)(O)O)cc3)co2)cc1 |
| InChI | InChI=1S/C21H22N3O6P/c22-11-16-3-7-18(8-4-16)20-24-19(12-29-20)17-5-1-15(2-6-17)9-10-21(23,13-25)14-30-31(26,27)28/h1-8,12,25H,9-10,13-14,23H2,(H2,26,27,28) |
| InChIKey | GHEIWXPSGFFNDM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 162.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|