C15H19Cl2N — CID 118722533
12-chlorotetracyclo[8.3.1.18,12.02,7]pentadeca-2,4,6-trien-10-amine;hydrochloride (PubChem CID 118722533) has the molecular formula C15H19Cl2N and a molecular weight of 284.23 g/mol. Its IUPAC name is 12-chlorotetracyclo[8.3.1.18,12.02,7]pentadeca-2,4,6-trien-10-amine;hydrochloride.
| Compound Name | 12-chlorotetracyclo[8.3.1.18,12.02,7]pentadeca-2,4,6-trien-10-amine;hydrochloride |
|---|---|
| PubChem CID | 118722533 |
| Molecular Formula | C15H19Cl2N |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 12-chlorotetracyclo[8.3.1.18,12.02,7]pentadeca-2,4,6-trien-10-amine;hydrochloride |
| SMILES | Cl.NC12CC3CC(Cl)(CC(C1)c1ccccc13)C2 |
| InChI | InChI=1S/C15H18ClN.ClH/c16-14-5-10-7-15(17,9-14)8-11(6-14)13-4-2-1-3-12(10)13;/h1-4,10-11H,5-9,17H2;1H |
| InChIKey | QMYXMCOWKBLVOI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|