C12H13NiO- — CID 134945587
(8R)-8-methanidyltricyclo[7.1.1.02,7]undeca-2,4,6-trien-9-ol;nickel (PubChem CID 134945587) has the molecular formula C12H13NiO- and a molecular weight of 231.93 g/mol. Its IUPAC name is (8R)-8-methanidyltricyclo[7.1.1.02,7]undeca-2,4,6-trien-9-ol;nickel.
| Compound Name | (8R)-8-methanidyltricyclo[7.1.1.02,7]undeca-2,4,6-trien-9-ol;nickel |
|---|---|
| PubChem CID | 134945587 |
| Molecular Formula | C12H13NiO- |
| Molecular Weight | 231.93 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | (8R)-8-methanidyltricyclo[7.1.1.02,7]undeca-2,4,6-trien-9-ol;nickel |
| SMILES | [CH2-][C@@H]1c2ccccc2C2CC1(O)C2.[Ni] |
| InChI | InChI=1S/C12H13O.Ni/c1-8-10-4-2-3-5-11(10)9-6-12(8,13)7-9;/h2-5,8-9,13H,1,6-7H2;/q-1;/t8-,9?,12?;/m1./s1 |
| InChIKey | YRRYGYIHEVIAEN-OXZVMSIMSA-N |
| XLogP | 2.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.93 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|