C28H32FN5O6 — CID 118727053
N-[3-[4-[2-[(4-fluorophenyl)methyl]-5-methoxy-1-methyl-6-oxopyrimidine-4-carbonyl]piperazin-1-yl]propyl]-3,4-dihydroxybenzamide (PubChem CID 118727053) has the molecular formula C28H32FN5O6 and a molecular weight of 553.59 g/mol. Its IUPAC name is N-[3-[4-[2-[(4-fluorophenyl)methyl]-5-methoxy-1-methyl-6-oxopyrimidine-4-carbonyl]piperazin-1-yl]propyl]-3,4-dihydroxybenzamide.
| Compound Name | N-[3-[4-[2-[(4-fluorophenyl)methyl]-5-methoxy-1-methyl-6-oxopyrimidine-4-carbonyl]piperazin-1-yl]propyl]-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 118727053 |
| Molecular Formula | C28H32FN5O6 |
| Molecular Weight | 553.59 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | N-[3-[4-[2-[(4-fluorophenyl)methyl]-5-methoxy-1-methyl-6-oxopyrimidine-4-carbonyl]piperazin-1-yl]propyl]-3,4-dihydroxybenzamide |
| SMILES | COc1c(C(=O)N2CCN(CCCNC(=O)c3ccc(O)c(O)c3)CC2)nc(Cc2ccc(F)cc2)n(C)c1=O |
| InChI | InChI=1S/C28H32FN5O6/c1-32-23(16-18-4-7-20(29)8-5-18)31-24(25(40-2)28(32)39)27(38)34-14-12-33(13-15-34)11-3-10-30-26(37)19-6-9-21(35)22(36)17-19/h4-9,17,35-36H,3,10-16H2,1-2H3,(H,30,37) |
| InChIKey | UIKYCFRFIDGLEM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.59 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|