C27H29N7O — CID 118732256
2-[[4-[[7-(2,4,6-trimethylphenoxy)-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]amino]piperidin-1-yl]methyl]benzonitrile (PubChem CID 118732256) has the molecular formula C27H29N7O and a molecular weight of 467.58 g/mol. Its IUPAC name is 2-[[4-[[7-(2,4,6-trimethylphenoxy)-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]amino]piperidin-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[4-[[7-(2,4,6-trimethylphenoxy)-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]amino]piperidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 118732256 |
| Molecular Formula | C27H29N7O |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 2-[[4-[[7-(2,4,6-trimethylphenoxy)-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]amino]piperidin-1-yl]methyl]benzonitrile |
| SMILES | Cc1cc(C)c(Oc2cc(NC3CCN(Cc4ccccc4C#N)CC3)nc3ncnn23)c(C)c1 |
| InChI | InChI=1S/C27H29N7O/c1-18-12-19(2)26(20(3)13-18)35-25-14-24(32-27-29-17-30-34(25)27)31-23-8-10-33(11-9-23)16-22-7-5-4-6-21(22)15-28/h4-7,12-14,17,23H,8-11,16H2,1-3H3,(H,29,30,31,32) |
| InChIKey | HJNSUNKOTFOWKN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 91.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |