C27H32N6O — CID 118732260
N-[1-[(4-methylphenyl)methyl]piperidin-4-yl]-7-(2,4,6-trimethylphenoxy)-[1,2,4]triazolo[1,5-a]pyrimidin-5-amine (PubChem CID 118732260) has the molecular formula C27H32N6O and a molecular weight of 456.59 g/mol. Its IUPAC name is N-[1-[(4-methylphenyl)methyl]piperidin-4-yl]-7-(2,4,6-trimethylphenoxy)-[1,2,4]triazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | N-[1-[(4-methylphenyl)methyl]piperidin-4-yl]-7-(2,4,6-trimethylphenoxy)-[1,2,4]triazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 118732260 |
| Molecular Formula | C27H32N6O |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | N-[1-[(4-methylphenyl)methyl]piperidin-4-yl]-7-(2,4,6-trimethylphenoxy)-[1,2,4]triazolo[1,5-a]pyrimidin-5-amine |
| SMILES | Cc1ccc(CN2CCC(Nc3cc(Oc4c(C)cc(C)cc4C)n4ncnc4n3)CC2)cc1 |
| InChI | InChI=1S/C27H32N6O/c1-18-5-7-22(8-6-18)16-32-11-9-23(10-12-32)30-24-15-25(33-27(31-24)28-17-29-33)34-26-20(3)13-19(2)14-21(26)4/h5-8,13-15,17,23H,9-12,16H2,1-4H3,(H,28,29,30,31) |
| InChIKey | KCRKROXLZWIFIT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |