C26H29FN6O — CID 118732257
N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-7-(2,4,6-trimethylphenoxy)-[1,2,4]triazolo[1,5-a]pyrimidin-5-amine (PubChem CID 118732257) has the molecular formula C26H29FN6O and a molecular weight of 460.56 g/mol. Its IUPAC name is N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-7-(2,4,6-trimethylphenoxy)-[1,2,4]triazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-7-(2,4,6-trimethylphenoxy)-[1,2,4]triazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 118732257 |
| Molecular Formula | C26H29FN6O |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-7-(2,4,6-trimethylphenoxy)-[1,2,4]triazolo[1,5-a]pyrimidin-5-amine |
| SMILES | Cc1cc(C)c(Oc2cc(NC3CCN(Cc4ccc(F)cc4)CC3)nc3ncnn23)c(C)c1 |
| InChI | InChI=1S/C26H29FN6O/c1-17-12-18(2)25(19(3)13-17)34-24-14-23(31-26-28-16-29-33(24)26)30-22-8-10-32(11-9-22)15-20-4-6-21(27)7-5-20/h4-7,12-14,16,22H,8-11,15H2,1-3H3,(H,28,29,30,31) |
| InChIKey | KUXHMSODHPAZNT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |