C20H17N3O6 — CID 118735572
6-(3-aminopropyl)-8-hydroxy-9-methoxy-3-nitroindeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 118735572) has the molecular formula C20H17N3O6 and a molecular weight of 395.37 g/mol. Its IUPAC name is 6-(3-aminopropyl)-8-hydroxy-9-methoxy-3-nitroindeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 6-(3-aminopropyl)-8-hydroxy-9-methoxy-3-nitroindeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 118735572 |
| Molecular Formula | C20H17N3O6 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 6-(3-aminopropyl)-8-hydroxy-9-methoxy-3-nitroindeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | COc1cc2c(cc1O)-c1c(c3ccc([N+](=O)[O-])cc3c(=O)n1CCCN)C2=O |
| InChI | InChI=1S/C20H17N3O6/c1-29-16-9-13-12(8-15(16)24)18-17(19(13)25)11-4-3-10(23(27)28)7-14(11)20(26)22(18)6-2-5-21/h3-4,7-9,24H,2,5-6,21H2,1H3 |
| InChIKey | WXPNHMDRFOTTDU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 137.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|