C21H27F6N5O4S — CID 118746155
2-methyl-4-[[6-(pyrrolidin-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118746155) has the molecular formula C21H27F6N5O4S and a molecular weight of 559.53 g/mol. Its IUPAC name is 2-methyl-4-[[6-(pyrrolidin-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-methyl-4-[[6-(pyrrolidin-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118746155 |
| Molecular Formula | C21H27F6N5O4S |
| Molecular Weight | 559.53 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | 2-methyl-4-[[6-(pyrrolidin-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nc(CN2Cc3nccn3CC(CN3CCCC3)C2)cs1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25N5S.2C2HF3O2/c1-14-19-16(13-23-14)11-21-9-15(8-20-5-2-3-6-20)10-22-7-4-18-17(22)12-21;2*3-2(4,5)1(6)7/h4,7,13,15H,2-3,5-6,8-12H2,1H3;2*(H,6,7) |
| InChIKey | INDVZQMYLGBAGH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |