C19H25F3N4O3S — CID 118743596
4-[[6-(cyclopropylmethoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid (PubChem CID 118743596) has the molecular formula C19H25F3N4O3S and a molecular weight of 446.50 g/mol. Its IUPAC name is 4-[[6-(cyclopropylmethoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[6-(cyclopropylmethoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118743596 |
| Molecular Formula | C19H25F3N4O3S |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 4-[[6-(cyclopropylmethoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2Cc3nccn3CC(COCC3CC3)C2)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N4OS.C2HF3O2/c1-13-19-16(12-23-13)8-20-6-15(11-22-10-14-2-3-14)7-21-5-4-18-17(21)9-20;3-2(4,5)1(6)7/h4-5,12,14-15H,2-3,6-11H2,1H3;(H,6,7) |
| InChIKey | KAURSVIDPMEKTC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |