C16H20F3N5O4S — CID 118744572
6-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine-8-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 118744572) has the molecular formula C16H20F3N5O4S and a molecular weight of 435.43 g/mol. Its IUPAC name is 6-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine-8-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 6-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine-8-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118744572 |
| Molecular Formula | C16H20F3N5O4S |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 6-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine-8-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(COCC2CN(C(N)=O)Cc3nccn3C2)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H19N5O2S.C2HF3O2/c1-10-17-12(9-22-10)8-21-7-11-4-18-3-2-16-13(18)6-19(5-11)14(15)20;3-2(4,5)1(6)7/h2-3,9,11H,4-8H2,1H3,(H2,15,20);(H,6,7) |
| InChIKey | PXLQYSVIKNXUEI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |