C14H16O3 — CID 118753585
1-(6-hydroxynaphthalen-2-yl)butane-2,3-diol (PubChem CID 118753585) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-(6-hydroxynaphthalen-2-yl)butane-2,3-diol.
| Compound Name | 1-(6-hydroxynaphthalen-2-yl)butane-2,3-diol |
|---|---|
| PubChem CID | 118753585 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 1-(6-hydroxynaphthalen-2-yl)butane-2,3-diol |
| SMILES | CC(O)C(O)Cc1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C14H16O3/c1-9(15)14(17)7-10-2-3-12-8-13(16)5-4-11(12)6-10/h2-6,8-9,14-17H,7H2,1H3 |
| InChIKey | VURKJRPIIZIBLT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |