C24H23NO10 — CID 118753594
(2S,3S,4S,5R)-6-[4-[2-(2-carboxyethyl)-5-phenyl-1,3-oxazol-4-yl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 118753594) has the molecular formula C24H23NO10 and a molecular weight of 485.45 g/mol. Its IUPAC name is (2S,3S,4S,5R)-6-[4-[2-(2-carboxyethyl)-5-phenyl-1,3-oxazol-4-yl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R)-6-[4-[2-(2-carboxyethyl)-5-phenyl-1,3-oxazol-4-yl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 118753594 |
| Molecular Formula | C24H23NO10 |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | (2S,3S,4S,5R)-6-[4-[2-(2-carboxyethyl)-5-phenyl-1,3-oxazol-4-yl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)CCc1nc(-c2ccc(OC3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)cc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C24H23NO10/c26-16(27)11-10-15-25-17(21(34-15)13-4-2-1-3-5-13)12-6-8-14(9-7-12)33-24-20(30)18(28)19(29)22(35-24)23(31)32/h1-9,18-20,22,24,28-30H,10-11H2,(H,26,27)(H,31,32)/t18-,19-,20+,22-,24?/m0/s1 |
| InChIKey | ORDARUCFJJHRLQ-UGQOMJHJSA-N |
| XLogP | 1.30 |
| TPSA | 179.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |