C19H26N2O5 — CID 118766140
6-ethyl-4-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecane-8-carbonyl]-1H-pyridin-2-one (PubChem CID 118766140) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is 6-ethyl-4-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecane-8-carbonyl]-1H-pyridin-2-one.
| Compound Name | 6-ethyl-4-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecane-8-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118766140 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 6-ethyl-4-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecane-8-carbonyl]-1H-pyridin-2-one |
| SMILES | CCc1cc(C(=O)N2C[C@H]3COCC[C@@]3(O)[C@@H]3COCC[C@@H]32)cc(=O)[nH]1 |
| InChI | InChI=1S/C19H26N2O5/c1-2-14-7-12(8-17(22)20-14)18(23)21-9-13-10-26-6-4-19(13,24)15-11-25-5-3-16(15)21/h7-8,13,15-16,24H,2-6,9-11H2,1H3,(H,20,22)/t13-,15+,16-,19-/m0/s1 |
| InChIKey | WPIIGCJMZNKGQN-YBKUAAOGSA-N |
| XLogP | 0.57 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |