C20H27NO6 — CID 118783227
(2,6-dimethoxyphenyl)-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecan-8-yl]methanone (PubChem CID 118783227) has the molecular formula C20H27NO6 and a molecular weight of 377.44 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl)-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecan-8-yl]methanone.
| Compound Name | (2,6-dimethoxyphenyl)-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecan-8-yl]methanone |
|---|---|
| PubChem CID | 118783227 |
| Molecular Formula | C20H27NO6 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | (2,6-dimethoxyphenyl)-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecan-8-yl]methanone |
| SMILES | COc1cccc(OC)c1C(=O)N1C[C@H]2COCC[C@@]2(O)[C@@H]2COCC[C@@H]21 |
| InChI | InChI=1S/C20H27NO6/c1-24-16-4-3-5-17(25-2)18(16)19(22)21-10-13-11-27-9-7-20(13,23)14-12-26-8-6-15(14)21/h3-5,13-15,23H,6-12H2,1-2H3/t13-,14+,15-,20-/m0/s1 |
| InChIKey | ZIZKJBJMSNRLCM-YYQBIWNASA-N |
| XLogP | 1.33 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |