C28H27ClN2O2S — CID 118885474
1-(4-tert-butylphenyl)sulfonyl-2-[(7-chloro-1H-indol-3-yl)methyl]-3-methylindole (PubChem CID 118885474) has the molecular formula C28H27ClN2O2S and a molecular weight of 491.06 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)sulfonyl-2-[(7-chloro-1H-indol-3-yl)methyl]-3-methylindole.
| Compound Name | 1-(4-tert-butylphenyl)sulfonyl-2-[(7-chloro-1H-indol-3-yl)methyl]-3-methylindole |
|---|---|
| PubChem CID | 118885474 |
| Molecular Formula | C28H27ClN2O2S |
| Molecular Weight | 491.06 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 1-(4-tert-butylphenyl)sulfonyl-2-[(7-chloro-1H-indol-3-yl)methyl]-3-methylindole |
| SMILES | Cc1c(Cc2c[nH]c3c(Cl)cccc23)n(S(=O)(=O)c2ccc(C(C)(C)C)cc2)c2ccccc12 |
| InChI | InChI=1S/C28H27ClN2O2S/c1-18-22-8-5-6-11-25(22)31(34(32,33)21-14-12-20(13-15-21)28(2,3)4)26(18)16-19-17-30-27-23(19)9-7-10-24(27)29/h5-15,17,30H,16H2,1-4H3 |
| InChIKey | FKXLNSCUQHWUNM-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.06 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |