C10H16F6O2 — CID 118912776
1,1,1-trifluoro-2-(2-methoxyethoxy)-2-(trifluoromethyl)hexane (PubChem CID 118912776) has the molecular formula C10H16F6O2 and a molecular weight of 282.22 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(2-methoxyethoxy)-2-(trifluoromethyl)hexane.
| Compound Name | 1,1,1-trifluoro-2-(2-methoxyethoxy)-2-(trifluoromethyl)hexane |
|---|---|
| PubChem CID | 118912776 |
| Molecular Formula | C10H16F6O2 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 1,1,1-trifluoro-2-(2-methoxyethoxy)-2-(trifluoromethyl)hexane |
| SMILES | CCCCC(OCCOC)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H16F6O2/c1-3-4-5-8(9(11,12)13,10(14,15)16)18-7-6-17-2/h3-7H2,1-2H3 |
| InChIKey | GFUOZNJCYOQQFJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|