C24H26F24O3 — CID 58741743
1,1,2,2,3,3,4,4-octafluoro-7-[1-(3,3,4,4,5,5,6,6-octafluorohexoxy)-2-(3,3,4,4,5,5,6,6-octafluorohexoxymethyl)butan-2-yl]oxyheptane (PubChem CID 58741743) has the molecular formula C24H26F24O3 and a molecular weight of 818.42 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-7-[1-(3,3,4,4,5,5,6,6-octafluorohexoxy)-2-(3,3,4,4,5,5,6,6-octafluorohexoxymethyl)butan-2-yl]oxyheptane.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-7-[1-(3,3,4,4,5,5,6,6-octafluorohexoxy)-2-(3,3,4,4,5,5,6,6-octafluorohexoxymethyl)butan-2-yl]oxyheptane |
|---|---|
| PubChem CID | 58741743 |
| Molecular Formula | C24H26F24O3 |
| Molecular Weight | 818.42 g/mol |
| Exact Mass | 818.15 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-7-[1-(3,3,4,4,5,5,6,6-octafluorohexoxy)-2-(3,3,4,4,5,5,6,6-octafluorohexoxymethyl)butan-2-yl]oxyheptane |
| SMILES | CCC(COCCC(F)(F)C(F)(F)C(F)(F)C(F)F)(COCCC(F)(F)C(F)(F)C(F)(F)C(F)F)OCCCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C24H26F24O3/c1-2-15(10-49-8-5-17(33,34)23(45,46)20(39,40)13(27)28,11-50-9-6-18(35,36)24(47,48)21(41,42)14(29)30)51-7-3-4-16(31,32)22(43,44)19(37,38)12(25)26/h12-14H,2-11H2,1H3 |
| InChIKey | CYIQPCKNGBYIPM-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.42 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|