C17H14N6O — CID 118926653
8-amino-2-(3-aminoanilino)-5H-pyrimido[5,4-c]isoquinolin-6-one (PubChem CID 118926653) has the molecular formula C17H14N6O and a molecular weight of 318.34 g/mol. Its IUPAC name is 8-amino-2-(3-aminoanilino)-5H-pyrimido[5,4-c]isoquinolin-6-one.
| Compound Name | 8-amino-2-(3-aminoanilino)-5H-pyrimido[5,4-c]isoquinolin-6-one |
|---|---|
| PubChem CID | 118926653 |
| Molecular Formula | C17H14N6O |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 8-amino-2-(3-aminoanilino)-5H-pyrimido[5,4-c]isoquinolin-6-one |
| SMILES | Nc1cccc(Nc2ncc3[nH]c(=O)c4cc(N)ccc4c3n2)c1 |
| InChI | InChI=1S/C17H14N6O/c18-9-2-1-3-11(6-9)21-17-20-8-14-15(23-17)12-5-4-10(19)7-13(12)16(24)22-14/h1-8H,18-19H2,(H,22,24)(H,20,21,23) |
| InChIKey | ANSLAPNHXOSLGV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|