C25H19F3N2O2 — CID 118928916
N-[[5-(3-hydroxyphenyl)isoquinolin-8-yl]methyl]-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 118928916) has the molecular formula C25H19F3N2O2 and a molecular weight of 436.43 g/mol. Its IUPAC name is N-[[5-(3-hydroxyphenyl)isoquinolin-8-yl]methyl]-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[[5-(3-hydroxyphenyl)isoquinolin-8-yl]methyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 118928916 |
| Molecular Formula | C25H19F3N2O2 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | N-[[5-(3-hydroxyphenyl)isoquinolin-8-yl]methyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1cccc(C(F)(F)F)c1)NCc1ccc(-c2cccc(O)c2)c2ccncc12 |
| InChI | InChI=1S/C25H19F3N2O2/c26-25(27,28)19-5-1-3-16(11-19)12-24(32)30-14-18-7-8-21(17-4-2-6-20(31)13-17)22-9-10-29-15-23(18)22/h1-11,13,15,31H,12,14H2,(H,30,32) |
| InChIKey | HLCBZAZCFIZMPB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |