C11H9N9OS — CID 118944498
2-azido-N-(azidomethyl)-N-(2-pyridin-3-yl-1,3-thiazol-5-yl)acetamide (PubChem CID 118944498) has the molecular formula C11H9N9OS and a molecular weight of 315.32 g/mol. Its IUPAC name is 2-azido-N-(azidomethyl)-N-(2-pyridin-3-yl-1,3-thiazol-5-yl)acetamide.
| Compound Name | 2-azido-N-(azidomethyl)-N-(2-pyridin-3-yl-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 118944498 |
| Molecular Formula | C11H9N9OS |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 2-azido-N-(azidomethyl)-N-(2-pyridin-3-yl-1,3-thiazol-5-yl)acetamide |
| SMILES | [N-]=[N+]=NCC(=O)N(CN=[N+]=[N-])c1cnc(-c2cccnc2)s1 |
| InChI | InChI=1S/C11H9N9OS/c12-18-16-5-9(21)20(7-17-19-13)10-6-15-11(22-10)8-2-1-3-14-4-8/h1-4,6H,5,7H2 |
| InChIKey | QAVBTNXDASJLKU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 143.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|