C25H21ClF3NO2 — CID 118948699
4-(chloromethyl)-N-[4-methyl-3-[3-(oxetan-3-yl)phenyl]phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 118948699) has the molecular formula C25H21ClF3NO2 and a molecular weight of 459.90 g/mol. Its IUPAC name is 4-(chloromethyl)-N-[4-methyl-3-[3-(oxetan-3-yl)phenyl]phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | 4-(chloromethyl)-N-[4-methyl-3-[3-(oxetan-3-yl)phenyl]phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 118948699 |
| Molecular Formula | C25H21ClF3NO2 |
| Molecular Weight | 459.90 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 4-(chloromethyl)-N-[4-methyl-3-[3-(oxetan-3-yl)phenyl]phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(CCl)c(C(F)(F)F)c2)cc1-c1cccc(C2COC2)c1 |
| InChI | InChI=1S/C25H21ClF3NO2/c1-15-5-8-21(11-22(15)17-4-2-3-16(9-17)20-13-32-14-20)30-24(31)18-6-7-19(12-26)23(10-18)25(27,28)29/h2-11,20H,12-14H2,1H3,(H,30,31) |
| InChIKey | CJDOFLRYZHBZEX-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.90 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|