C22H27NO6 — CID 118948795
3-[6-[2-(oxan-2-yloxy)ethoxy]-4-phenylmethoxy-2-pyridinyl]oxetan-3-ol (PubChem CID 118948795) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is 3-[6-[2-(oxan-2-yloxy)ethoxy]-4-phenylmethoxy-2-pyridinyl]oxetan-3-ol.
| Compound Name | 3-[6-[2-(oxan-2-yloxy)ethoxy]-4-phenylmethoxy-2-pyridinyl]oxetan-3-ol |
|---|---|
| PubChem CID | 118948795 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 3-[6-[2-(oxan-2-yloxy)ethoxy]-4-phenylmethoxy-2-pyridinyl]oxetan-3-ol |
| SMILES | OC1(c2cc(OCc3ccccc3)cc(OCCOC3CCCCO3)n2)COC1 |
| InChI | InChI=1S/C22H27NO6/c24-22(15-25-16-22)19-12-18(29-14-17-6-2-1-3-7-17)13-20(23-19)26-10-11-28-21-8-4-5-9-27-21/h1-3,6-7,12-13,21,24H,4-5,8-11,14-16H2 |
| InChIKey | IRRARNIAIPDYNO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|