C24H30FNO5 — CID 118948957
2-(4-fluorooxan-4-yl)-6-[2-(oxan-2-yloxy)ethoxy]-4-phenylmethoxypyridine (PubChem CID 118948957) has the molecular formula C24H30FNO5 and a molecular weight of 431.50 g/mol. Its IUPAC name is 2-(4-fluorooxan-4-yl)-6-[2-(oxan-2-yloxy)ethoxy]-4-phenylmethoxypyridine.
| Compound Name | 2-(4-fluorooxan-4-yl)-6-[2-(oxan-2-yloxy)ethoxy]-4-phenylmethoxypyridine |
|---|---|
| PubChem CID | 118948957 |
| Molecular Formula | C24H30FNO5 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 2-(4-fluorooxan-4-yl)-6-[2-(oxan-2-yloxy)ethoxy]-4-phenylmethoxypyridine |
| SMILES | FC1(c2cc(OCc3ccccc3)cc(OCCOC3CCCCO3)n2)CCOCC1 |
| InChI | InChI=1S/C24H30FNO5/c25-24(9-12-27-13-10-24)21-16-20(31-18-19-6-2-1-3-7-19)17-22(26-21)28-14-15-30-23-8-4-5-11-29-23/h1-3,6-7,16-17,23H,4-5,8-15,18H2 |
| InChIKey | RXCYXMDHIXAHBR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 59.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|