C15H22N2O2S — CID 118960501
4-benzyl-1λ6-thia-4,9-diazaspiro[5.5]undecane 1,1-dioxide (PubChem CID 118960501) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is 4-benzyl-1λ6-thia-4,9-diazaspiro[5.5]undecane 1,1-dioxide.
| Compound Name | 4-benzyl-1λ6-thia-4,9-diazaspiro[5.5]undecane 1,1-dioxide |
|---|---|
| PubChem CID | 118960501 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 4-benzyl-1λ6-thia-4,9-diazaspiro[5.5]undecane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(Cc2ccccc2)CC12CCNCC2 |
| InChI | InChI=1S/C15H22N2O2S/c18-20(19)11-10-17(12-14-4-2-1-3-5-14)13-15(20)6-8-16-9-7-15/h1-5,16H,6-13H2 |
| InChIKey | YJCPAFCQIIVPED-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |