C10H12OS — CID 118966158
2-(1-buta-1,3-dienoxyethyl)thiophene (PubChem CID 118966158) has the molecular formula C10H12OS and a molecular weight of 180.27 g/mol. Its IUPAC name is 2-(1-buta-1,3-dienoxyethyl)thiophene.
| Compound Name | 2-(1-buta-1,3-dienoxyethyl)thiophene |
|---|---|
| PubChem CID | 118966158 |
| Molecular Formula | C10H12OS |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 2-(1-buta-1,3-dienoxyethyl)thiophene |
| SMILES | C=CC=COC(C)c1cccs1 |
| InChI | InChI=1S/C10H12OS/c1-3-4-7-11-9(2)10-6-5-8-12-10/h3-9H,1H2,2H3 |
| InChIKey | PCTCXZBWFQNILJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|