C11H22N2O — CID 118968946
1-(1-methoxyethenyl)-4-propan-2-yl-1,4-diazepane (PubChem CID 118968946) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-(1-methoxyethenyl)-4-propan-2-yl-1,4-diazepane.
| Compound Name | 1-(1-methoxyethenyl)-4-propan-2-yl-1,4-diazepane |
|---|---|
| PubChem CID | 118968946 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 1-(1-methoxyethenyl)-4-propan-2-yl-1,4-diazepane |
| SMILES | C=C(OC)N1CCCN(C(C)C)CC1 |
| InChI | InChI=1S/C11H22N2O/c1-10(2)12-6-5-7-13(9-8-12)11(3)14-4/h10H,3,5-9H2,1-2,4H3 |
| InChIKey | VBQCHHJZKSBFOG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|