C54H46O16 — CID 118970575
[(3R,5S,6S)-3,4,5-tribenzoyloxy-6-[2-(4-butoxy-3-hydroxyphenyl)-5-hydroxy-3-methoxy-4-oxochromen-7-yl]oxyoxan-2-yl]methyl benzoate (PubChem CID 118970575) has the molecular formula C54H46O16 and a molecular weight of 950.95 g/mol. Its IUPAC name is [(3R,5S,6S)-3,4,5-tribenzoyloxy-6-[2-(4-butoxy-3-hydroxyphenyl)-5-hydroxy-3-methoxy-4-oxochromen-7-yl]oxyoxan-2-yl]methyl benzoate.
| Compound Name | [(3R,5S,6S)-3,4,5-tribenzoyloxy-6-[2-(4-butoxy-3-hydroxyphenyl)-5-hydroxy-3-methoxy-4-oxochromen-7-yl]oxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 118970575 |
| Molecular Formula | C54H46O16 |
| Molecular Weight | 950.95 g/mol |
| Exact Mass | 950.28 |
| IUPAC Name | [(3R,5S,6S)-3,4,5-tribenzoyloxy-6-[2-(4-butoxy-3-hydroxyphenyl)-5-hydroxy-3-methoxy-4-oxochromen-7-yl]oxyoxan-2-yl]methyl benzoate |
| SMILES | CCCCOc1ccc(-c2oc3cc(O[C@@H]4OC(COC(=O)c5ccccc5)[C@@H](OC(=O)c5ccccc5)C(OC(=O)c5ccccc5)[C@@H]4OC(=O)c4ccccc4)cc(O)c3c(=O)c2OC)cc1O |
| InChI | InChI=1S/C54H46O16/c1-3-4-27-63-40-26-25-36(28-38(40)55)45-47(62-2)44(57)43-39(56)29-37(30-41(43)66-45)65-54-49(70-53(61)35-23-15-8-16-24-35)48(69-52(60)34-21-13-7-14-22-34)46(68-51(59)33-19-11-6-12-20-33)42(67-54)31-64-50(58)32-17-9-5-10-18-32/h5-26,28-30,42,46,48-49,54-56H,3-4,27,31H2,1-2H3/t42?,46-,48?,49+,54-/m1/s1 |
| InChIKey | VTJVILXADNSGLR-GCMRECJTSA-N |
| XLogP | 8.70 |
| TPSA | 212.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 950.95 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|