C51H40O16 — CID 132520406
[(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[2-(3,4-dihydroxyphenyl)-3-ethoxy-5-hydroxy-4-oxochromen-7-yl]oxyoxan-2-yl]methyl benzoate (PubChem CID 132520406) has the molecular formula C51H40O16 and a molecular weight of 908.87 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[2-(3,4-dihydroxyphenyl)-3-ethoxy-5-hydroxy-4-oxochromen-7-yl]oxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[2-(3,4-dihydroxyphenyl)-3-ethoxy-5-hydroxy-4-oxochromen-7-yl]oxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 132520406 |
| Molecular Formula | C51H40O16 |
| Molecular Weight | 908.87 g/mol |
| Exact Mass | 908.23 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[2-(3,4-dihydroxyphenyl)-3-ethoxy-5-hydroxy-4-oxochromen-7-yl]oxyoxan-2-yl]methyl benzoate |
| SMILES | CCOc1c(-c2ccc(O)c(O)c2)oc2cc(O[C@@H]3O[C@H](COC(=O)c4ccccc4)[C@@H](OC(=O)c4ccccc4)[C@H](OC(=O)c4ccccc4)[C@H]3OC(=O)c3ccccc3)cc(O)c2c1=O |
| InChI | InChI=1S/C51H40O16/c1-2-60-44-41(55)40-37(54)26-34(27-38(40)63-42(44)33-23-24-35(52)36(53)25-33)62-51-46(67-50(59)32-21-13-6-14-22-32)45(66-49(58)31-19-11-5-12-20-31)43(65-48(57)30-17-9-4-10-18-30)39(64-51)28-61-47(56)29-15-7-3-8-16-29/h3-27,39,43,45-46,51-54H,2,28H2,1H3/t39-,43-,45+,46-,51-/m1/s1 |
| InChIKey | VCFOVRCEJFQTCI-XPFUZHQZSA-N |
| XLogP | 7.61 |
| TPSA | 223.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.87 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|