C55H46O15 — CID 42603409
[(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[5-hexanoyloxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl benzoate (PubChem CID 42603409) has the molecular formula C55H46O15 and a molecular weight of 946.96 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[5-hexanoyloxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[5-hexanoyloxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 42603409 |
| Molecular Formula | C55H46O15 |
| Molecular Weight | 946.96 g/mol |
| Exact Mass | 946.28 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[5-hexanoyloxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl benzoate |
| SMILES | CCCCCC(=O)Oc1cc(O[C@@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)cc2oc(-c3ccc(O)cc3)cc(=O)c12 |
| InChI | InChI=1S/C55H46O15/c1-2-3-8-25-46(58)66-44-31-40(30-43-47(44)41(57)32-42(65-43)34-26-28-39(56)29-27-34)64-55-50(70-54(62)38-23-15-7-16-24-38)49(69-53(61)37-21-13-6-14-22-37)48(68-52(60)36-19-11-5-12-20-36)45(67-55)33-63-51(59)35-17-9-4-10-18-35/h4-7,9-24,26-32,45,48-50,55-56H,2-3,8,25,33H2,1H3/t45-,48-,49+,50-,55-/m1/s1 |
| InChIKey | JYSJKHQENVNLMZ-HYOSKDOYSA-N |
| XLogP | 9.29 |
| TPSA | 200.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 946.96 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|