C20H20FN7OS — CID 118979558
5-[4-[(2,4-dimethyl-1,3-thiazol-5-yl)amino]-1,3,5-triazin-2-yl]-2-[(3S,4S)-3-fluoropiperidin-4-yl]oxybenzonitrile (PubChem CID 118979558) has the molecular formula C20H20FN7OS and a molecular weight of 425.49 g/mol. Its IUPAC name is 5-[4-[(2,4-dimethyl-1,3-thiazol-5-yl)amino]-1,3,5-triazin-2-yl]-2-[(3S,4S)-3-fluoropiperidin-4-yl]oxybenzonitrile.
| Compound Name | 5-[4-[(2,4-dimethyl-1,3-thiazol-5-yl)amino]-1,3,5-triazin-2-yl]-2-[(3S,4S)-3-fluoropiperidin-4-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 118979558 |
| Molecular Formula | C20H20FN7OS |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 5-[4-[(2,4-dimethyl-1,3-thiazol-5-yl)amino]-1,3,5-triazin-2-yl]-2-[(3S,4S)-3-fluoropiperidin-4-yl]oxybenzonitrile |
| SMILES | Cc1nc(C)c(Nc2ncnc(-c3ccc(O[C@H]4CCNC[C@@H]4F)c(C#N)c3)n2)s1 |
| InChI | InChI=1S/C20H20FN7OS/c1-11-19(30-12(2)26-11)28-20-25-10-24-18(27-20)13-3-4-16(14(7-13)8-22)29-17-5-6-23-9-15(17)21/h3-4,7,10,15,17,23H,5-6,9H2,1-2H3,(H,24,25,27,28)/t15-,17-/m0/s1 |
| InChIKey | MGKHPKYPMGSQOB-RDJZCZTQSA-N |
| XLogP | 3.31 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |