C22H16N2O3 — CID 11898404
(1R,5S)-4-(4-nitrophenyl)-6,6-diphenyl-2-oxa-3-azabicyclo[3.1.0]hex-3-ene (PubChem CID 11898404) has the molecular formula C22H16N2O3 and a molecular weight of 356.38 g/mol. Its IUPAC name is (1R,5S)-4-(4-nitrophenyl)-6,6-diphenyl-2-oxa-3-azabicyclo[3.1.0]hex-3-ene.
| Compound Name | (1R,5S)-4-(4-nitrophenyl)-6,6-diphenyl-2-oxa-3-azabicyclo[3.1.0]hex-3-ene |
|---|---|
| PubChem CID | 11898404 |
| Molecular Formula | C22H16N2O3 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (1R,5S)-4-(4-nitrophenyl)-6,6-diphenyl-2-oxa-3-azabicyclo[3.1.0]hex-3-ene |
| SMILES | O=[N+]([O-])c1ccc(C2=NO[C@@H]3[C@H]2C3(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H16N2O3/c25-24(26)18-13-11-15(12-14-18)20-19-21(27-23-20)22(19,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14,19,21H/t19-,21+/m0/s1 |
| InChIKey | OYSKUIOHXZPLOM-PZJWPPBQSA-N |
| XLogP | 4.31 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|