C21H19N3O3 — CID 118987455
[(4S,7R)-1-benzylspiro[5,6-dihydro-4H-benzotriazole-7,2'-oxirane]-4-yl] benzoate (PubChem CID 118987455) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is [(4S,7R)-1-benzylspiro[5,6-dihydro-4H-benzotriazole-7,2'-oxirane]-4-yl] benzoate.
| Compound Name | [(4S,7R)-1-benzylspiro[5,6-dihydro-4H-benzotriazole-7,2'-oxirane]-4-yl] benzoate |
|---|---|
| PubChem CID | 118987455 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | [(4S,7R)-1-benzylspiro[5,6-dihydro-4H-benzotriazole-7,2'-oxirane]-4-yl] benzoate |
| SMILES | O=C(O[C@H]1CC[C@]2(CO2)c2c1nnn2Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H19N3O3/c25-20(16-9-5-2-6-10-16)27-17-11-12-21(14-26-21)19-18(17)22-23-24(19)13-15-7-3-1-4-8-15/h1-10,17H,11-14H2/t17-,21-/m0/s1 |
| InChIKey | SJGHBLZMRRMDNN-UWJYYQICSA-N |
| XLogP | 3.24 |
| TPSA | 69.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|