C12H12Cl2N4O2 — CID 119035417
3-[(6,7-dichloroquinoxalin-2-yl)amino]-2-hydroxy-N-methylpropanamide (PubChem CID 119035417) has the molecular formula C12H12Cl2N4O2 and a molecular weight of 315.16 g/mol. Its IUPAC name is 3-[(6,7-dichloroquinoxalin-2-yl)amino]-2-hydroxy-N-methylpropanamide.
| Compound Name | 3-[(6,7-dichloroquinoxalin-2-yl)amino]-2-hydroxy-N-methylpropanamide |
|---|---|
| PubChem CID | 119035417 |
| Molecular Formula | C12H12Cl2N4O2 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 3-[(6,7-dichloroquinoxalin-2-yl)amino]-2-hydroxy-N-methylpropanamide |
| SMILES | CNC(=O)C(O)CNc1cnc2cc(Cl)c(Cl)cc2n1 |
| InChI | InChI=1S/C12H12Cl2N4O2/c1-15-12(20)10(19)4-17-11-5-16-8-2-6(13)7(14)3-9(8)18-11/h2-3,5,10,19H,4H2,1H3,(H,15,20)(H,17,18) |
| InChIKey | XJRIGKWSTASBSR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |