C19H28N4O3 — CID 119046998
1-tert-butyl-N-(3,4-dipropoxyphenyl)triazole-4-carboxamide (PubChem CID 119046998) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 1-tert-butyl-N-(3,4-dipropoxyphenyl)triazole-4-carboxamide.
| Compound Name | 1-tert-butyl-N-(3,4-dipropoxyphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 119046998 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 1-tert-butyl-N-(3,4-dipropoxyphenyl)triazole-4-carboxamide |
| SMILES | CCCOc1ccc(NC(=O)c2cn(C(C)(C)C)nn2)cc1OCCC |
| InChI | InChI=1S/C19H28N4O3/c1-6-10-25-16-9-8-14(12-17(16)26-11-7-2)20-18(24)15-13-23(22-21-15)19(3,4)5/h8-9,12-13H,6-7,10-11H2,1-5H3,(H,20,24) |
| InChIKey | FJYOTXMREDQCJH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |