C17H29N4O3+ — CID 11905726
[(1R,2R)-2-[[(5R)-1-hexyl-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]cyclohexyl]azanium (PubChem CID 11905726) has the molecular formula C17H29N4O3+ and a molecular weight of 337.44 g/mol. Its IUPAC name is [(1R,2R)-2-[[(5R)-1-hexyl-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]cyclohexyl]azanium.
| Compound Name | [(1R,2R)-2-[[(5R)-1-hexyl-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]cyclohexyl]azanium |
|---|---|
| PubChem CID | 11905726 |
| Molecular Formula | C17H29N4O3+ |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | [(1R,2R)-2-[[(5R)-1-hexyl-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]cyclohexyl]azanium |
| SMILES | CCCCCCN1C(=O)NC(=O)[C@@H](/C=N/[C@@H]2CCCC[C@H]2[NH3+])C1=O |
| InChI | InChI=1S/C17H28N4O3/c1-2-3-4-7-10-21-16(23)12(15(22)20-17(21)24)11-19-14-9-6-5-8-13(14)18/h11-14H,2-10,18H2,1H3,(H,20,22,24)/p+1/b19-11+/t12-,13-,14-/m1/s1 |
| InChIKey | CUAKNLZFQHWBSE-ISXNKXISSA-O |
| XLogP | 0.89 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|