C9H6BrFOS — CID 119084628
8-bromo-6-fluoro-2,3-dihydrothiochromen-4-one (PubChem CID 119084628) has the molecular formula C9H6BrFOS and a molecular weight of 261.11 g/mol. Its IUPAC name is 8-bromo-6-fluoro-2,3-dihydrothiochromen-4-one.
| Compound Name | 8-bromo-6-fluoro-2,3-dihydrothiochromen-4-one |
|---|---|
| PubChem CID | 119084628 |
| Molecular Formula | C9H6BrFOS |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 259.93 |
| IUPAC Name | 8-bromo-6-fluoro-2,3-dihydrothiochromen-4-one |
| SMILES | O=C1CCSc2c(Br)cc(F)cc21 |
| InChI | InChI=1S/C9H6BrFOS/c10-7-4-5(11)3-6-8(12)1-2-13-9(6)7/h3-4H,1-2H2 |
| InChIKey | LAHFYISIFBPWGY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |