C7H6Br2N2 — CID 119094874
3-(2,2-dibromoethenyl)pyridin-2-amine (PubChem CID 119094874) has the molecular formula C7H6Br2N2 and a molecular weight of 277.95 g/mol. Its IUPAC name is 3-(2,2-dibromoethenyl)pyridin-2-amine.
| Compound Name | 3-(2,2-dibromoethenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 119094874 |
| Molecular Formula | C7H6Br2N2 |
| Molecular Weight | 277.95 g/mol |
| Exact Mass | 275.89 |
| IUPAC Name | 3-(2,2-dibromoethenyl)pyridin-2-amine |
| SMILES | Nc1ncccc1C=C(Br)Br |
| InChI | InChI=1S/C7H6Br2N2/c8-6(9)4-5-2-1-3-11-7(5)10/h1-4H,(H2,10,11) |
| InChIKey | SHWQSAJZXCTTAM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.95 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |