C12H16BF3O3 — CID 119094942
[4-(1,1-difluorohexoxy)-2-fluorophenyl]boronic acid (PubChem CID 119094942) has the molecular formula C12H16BF3O3 and a molecular weight of 276.06 g/mol. Its IUPAC name is [4-(1,1-difluorohexoxy)-2-fluorophenyl]boronic acid.
| Compound Name | [4-(1,1-difluorohexoxy)-2-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 119094942 |
| Molecular Formula | C12H16BF3O3 |
| Molecular Weight | 276.06 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | [4-(1,1-difluorohexoxy)-2-fluorophenyl]boronic acid |
| SMILES | CCCCCC(F)(F)Oc1ccc(B(O)O)c(F)c1 |
| InChI | InChI=1S/C12H16BF3O3/c1-2-3-4-7-12(15,16)19-9-5-6-10(13(17)18)11(14)8-9/h5-6,8,17-18H,2-4,7H2,1H3 |
| InChIKey | MFDOWFGIXXFEQT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.06 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|