C17H16N2OS2 — CID 119099273
N-(1-thiophen-2-ylcyclopentyl)-1,3-benzothiazole-2-carboxamide (PubChem CID 119099273) has the molecular formula C17H16N2OS2 and a molecular weight of 328.46 g/mol. Its IUPAC name is N-(1-thiophen-2-ylcyclopentyl)-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-(1-thiophen-2-ylcyclopentyl)-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 119099273 |
| Molecular Formula | C17H16N2OS2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | N-(1-thiophen-2-ylcyclopentyl)-1,3-benzothiazole-2-carboxamide |
| SMILES | O=C(NC1(c2cccs2)CCCC1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H16N2OS2/c20-15(16-18-12-6-1-2-7-13(12)22-16)19-17(9-3-4-10-17)14-8-5-11-21-14/h1-2,5-8,11H,3-4,9-10H2,(H,19,20) |
| InChIKey | BOZUNFIKNVTMQO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |