C16H18O — CID 11914682
(1R,2S,5S,6R,7S)-7-phenoxytricyclo[4.2.2.02,5]dec-3-ene (PubChem CID 11914682) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is (1R,2S,5S,6R,7S)-7-phenoxytricyclo[4.2.2.02,5]dec-3-ene.
| Compound Name | (1R,2S,5S,6R,7S)-7-phenoxytricyclo[4.2.2.02,5]dec-3-ene |
|---|---|
| PubChem CID | 11914682 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | (1R,2S,5S,6R,7S)-7-phenoxytricyclo[4.2.2.02,5]dec-3-ene |
| SMILES | C1=C[C@H]2[C@H]1[C@@H]1CC[C@H]2[C@@H](Oc2ccccc2)C1 |
| InChI | InChI=1S/C16H18O/c1-2-4-12(5-3-1)17-16-10-11-6-7-15(16)14-9-8-13(11)14/h1-5,8-9,11,13-16H,6-7,10H2/t11-,13-,14+,15-,16+/m1/s1 |
| InChIKey | DDUXCRUGWWAJRA-JZYAIQKZSA-N |
| XLogP | 3.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|