C18H28N4O2S — CID 119156918
1-(1,3-benzodioxol-5-ylmethyl)-3-[[3-(dimethylamino)thiolan-3-yl]methyl]-1,2-dimethylguanidine (PubChem CID 119156918) has the molecular formula C18H28N4O2S and a molecular weight of 364.52 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[[3-(dimethylamino)thiolan-3-yl]methyl]-1,2-dimethylguanidine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[[3-(dimethylamino)thiolan-3-yl]methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 119156918 |
| Molecular Formula | C18H28N4O2S |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[[3-(dimethylamino)thiolan-3-yl]methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\NCC1(N(C)C)CCSC1)N(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H28N4O2S/c1-19-17(20-11-18(21(2)3)7-8-25-12-18)22(4)10-14-5-6-15-16(9-14)24-13-23-15/h5-6,9H,7-8,10-13H2,1-4H3,(H,19,20) |
| InChIKey | NPXJGZLMMJOBFK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|