C20H20N2O5S — CID 11935006
(2-cyanophenyl)methyl (2S)-1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 11935006) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is (2-cyanophenyl)methyl (2S)-1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | (2-cyanophenyl)methyl (2S)-1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11935006 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | (2-cyanophenyl)methyl (2S)-1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | COc1ccc(S(=O)(=O)N2CCC[C@H]2C(=O)OCc2ccccc2C#N)cc1 |
| InChI | InChI=1S/C20H20N2O5S/c1-26-17-8-10-18(11-9-17)28(24,25)22-12-4-7-19(22)20(23)27-14-16-6-3-2-5-15(16)13-21/h2-3,5-6,8-11,19H,4,7,12,14H2,1H3/t19-/m0/s1 |
| InChIKey | PBJOMCURXDHQRG-IBGZPJMESA-N |
| XLogP | 2.46 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |