C18H26ClNO5 — CID 119357380
4-[(4-butoxy-3-chloro-5-methoxybenzoyl)amino]-4-methylpentanoic acid (PubChem CID 119357380) has the molecular formula C18H26ClNO5 and a molecular weight of 371.86 g/mol. Its IUPAC name is 4-[(4-butoxy-3-chloro-5-methoxybenzoyl)amino]-4-methylpentanoic acid.
| Compound Name | 4-[(4-butoxy-3-chloro-5-methoxybenzoyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119357380 |
| Molecular Formula | C18H26ClNO5 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 4-[(4-butoxy-3-chloro-5-methoxybenzoyl)amino]-4-methylpentanoic acid |
| SMILES | CCCCOc1c(Cl)cc(C(=O)NC(C)(C)CCC(=O)O)cc1OC |
| InChI | InChI=1S/C18H26ClNO5/c1-5-6-9-25-16-13(19)10-12(11-14(16)24-4)17(23)20-18(2,3)8-7-15(21)22/h10-11H,5-9H2,1-4H3,(H,20,23)(H,21,22) |
| InChIKey | GDUIPIPRDVLBJP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|