C19H31ClN2O — CID 119399928
N-(2-tert-butylphenyl)-3-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119399928) has the molecular formula C19H31ClN2O and a molecular weight of 338.92 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-3-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | N-(2-tert-butylphenyl)-3-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119399928 |
| Molecular Formula | C19H31ClN2O |
| Molecular Weight | 338.92 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | N-(2-tert-butylphenyl)-3-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)Nc1ccccc1C(C)(C)C)C1CCNCC1.Cl |
| InChI | InChI=1S/C19H30N2O.ClH/c1-14(15-9-11-20-12-10-15)13-18(22)21-17-8-6-5-7-16(17)19(2,3)4;/h5-8,14-15,20H,9-13H2,1-4H3,(H,21,22);1H |
| InChIKey | OPQDWUVWRMOPGV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.92 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |