C16H23ClF2N2OS — CID 119687144
N-[2-(difluoromethylsulfanyl)phenyl]-3-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119687144) has the molecular formula C16H23ClF2N2OS and a molecular weight of 364.89 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfanyl)phenyl]-3-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | N-[2-(difluoromethylsulfanyl)phenyl]-3-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119687144 |
| Molecular Formula | C16H23ClF2N2OS |
| Molecular Weight | 364.89 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-[2-(difluoromethylsulfanyl)phenyl]-3-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)Nc1ccccc1SC(F)F)C1CCNCC1.Cl |
| InChI | InChI=1S/C16H22F2N2OS.ClH/c1-11(12-6-8-19-9-7-12)10-15(21)20-13-4-2-3-5-14(13)22-16(17)18;/h2-5,11-12,16,19H,6-10H2,1H3,(H,20,21);1H |
| InChIKey | FXEYDXBQFNMARQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.89 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |