C20H28ClN3O3 — CID 119752264
N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119752264) has the molecular formula C20H28ClN3O3 and a molecular weight of 393.92 g/mol. Its IUPAC name is N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119752264 |
| Molecular Formula | C20H28ClN3O3 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)Nc1ccccc1CN1C(=O)CCC1=O)C1CCNCC1.Cl |
| InChI | InChI=1S/C20H27N3O3.ClH/c1-14(15-8-10-21-11-9-15)12-18(24)22-17-5-3-2-4-16(17)13-23-19(25)6-7-20(23)26;/h2-5,14-15,21H,6-13H2,1H3,(H,22,24);1H |
| InChIKey | BZUKKCXYPNKGAZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|