C17H25ClF2N2O2 — CID 119814484
N-[2-(2,2-difluoroethoxy)phenyl]-3-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119814484) has the molecular formula C17H25ClF2N2O2 and a molecular weight of 362.85 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)phenyl]-3-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | N-[2-(2,2-difluoroethoxy)phenyl]-3-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119814484 |
| Molecular Formula | C17H25ClF2N2O2 |
| Molecular Weight | 362.85 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)phenyl]-3-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)Nc1ccccc1OCC(F)F)C1CCNCC1.Cl |
| InChI | InChI=1S/C17H24F2N2O2.ClH/c1-12(13-6-8-20-9-7-13)10-17(22)21-14-4-2-3-5-15(14)23-11-16(18)19;/h2-5,12-13,16,20H,6-11H2,1H3,(H,21,22);1H |
| InChIKey | PWPSLMWPMSBULQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.85 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |