C18H29N3O — CID 122080277
N-[2-(ethylaminomethyl)phenyl]-3-piperidin-4-ylbutanamide (PubChem CID 122080277) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is N-[2-(ethylaminomethyl)phenyl]-3-piperidin-4-ylbutanamide.
| Compound Name | N-[2-(ethylaminomethyl)phenyl]-3-piperidin-4-ylbutanamide |
|---|---|
| PubChem CID | 122080277 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | N-[2-(ethylaminomethyl)phenyl]-3-piperidin-4-ylbutanamide |
| SMILES | CCNCc1ccccc1NC(=O)CC(C)C1CCNCC1 |
| InChI | InChI=1S/C18H29N3O/c1-3-19-13-16-6-4-5-7-17(16)21-18(22)12-14(2)15-8-10-20-11-9-15/h4-7,14-15,19-20H,3,8-13H2,1-2H3,(H,21,22) |
| InChIKey | RHYRERONHPVCSU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |